Difference between revisions of "RXN-11502"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11502 RXN-11502] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-galactosidase * ec nu...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11502 RXN-11502] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** alpha-galactosidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1 EC-3.2.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[1. | + | * With identifiers: |
− | == | + | ** 1 [[CPD-1099]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ALPHA-D-GALACTOSE]][c] '''+''' 1 [[SUCROSE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 raffinose[c] '''+''' 1 H2O[c] '''=>''' 1 α-D-galactose[c] '''+''' 1 sucrose[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16101]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_4615]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_3392]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_8673]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6527]], stachyose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01103 R01103] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=alpha-galactosidase}} | |
− | + | {{#set: ec number=EC-3.2.1}} | |
− | + | {{#set: gene associated=Tiso_gene_16101|Tiso_gene_4615|Tiso_gene_3392|Tiso_gene_8673}} | |
− | + | {{#set: in pathway=PWY-6527}} | |
− | * LIGAND- | + | {{#set: reconstruction category=orthology|annotation}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-athaliana|orthology-creinhardtii}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:25, 21 March 2018
Contents
Reaction RXN-11502
- direction:
- LEFT-TO-RIGHT
- common name:
- alpha-galactosidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-1099[c] + 1 WATER[c] => 1 ALPHA-D-GALACTOSE[c] + 1 SUCROSE[c]
- With common name(s):
- 1 raffinose[c] + 1 H2O[c] => 1 α-D-galactose[c] + 1 sucrose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16101
- Source: orthology-creinhardtii
- Gene: Tiso_gene_4615
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3392
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8673
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: