Difference between revisions of "5.99.1.3-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * comm...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5.99.1.3-RXN 5.99.1.3-RXN] == * direction: ** REVERSIBLE * common name: ** dna_topoisomerase ** ORF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5.99.1.3-RXN 5.99.1.3-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
− | ** | + | ** dna_topoisomerase |
− | * | + | ** ORF |
− | ** | + | ** dna_topoisomerase_6_subunit_a |
− | * | + | ** dna_topoisomerase_2 |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/5.99.1.3 EC-5.99.1.3] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[1. | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[Double-Stranded-DNAs]][c] '''<=>''' 1 [[Pi]][c] '''+''' 1 [[Negatively-super-coiled-DNAs]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 a double stranded DNA[c] '''<=>''' 1 phosphate[c] '''+''' 1 a negatively supercoiled DNA[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_828]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_3610]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_3374]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_12629]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_1291]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_3728]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_3396]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6569]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_829]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7M3G2 Q7M3G2] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q02880 Q02880] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A0K8 P0A0K8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P41515 P41515] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12531 P12531] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P27570 P27570] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q03470 Q03470] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P35810 P35810] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43701 P43701] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9JX55 Q9JX55] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CH36 Q9CH36] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P20831 P20831] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9JTW5 Q9JTW5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P33769 P33769] |
+ | ** [http://www.uniprot.org/uniprot/P47250 P47250] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59189 Q59189] | ||
+ | ** [http://www.uniprot.org/uniprot/P05652 P05652] | ||
+ | ** [http://www.uniprot.org/uniprot/P43700 P43700] | ||
+ | ** [http://www.uniprot.org/uniprot/P05653 P05653] | ||
+ | ** [http://www.uniprot.org/uniprot/O87667 O87667] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9CGI5 Q9CGI5] | ||
+ | ** [http://www.uniprot.org/uniprot/P23992 P23992] | ||
+ | ** [http://www.uniprot.org/uniprot/P09176 P09176] | ||
+ | ** [http://www.uniprot.org/uniprot/P06786 P06786] | ||
+ | ** [http://www.uniprot.org/uniprot/P0AES6 P0AES6] | ||
+ | ** [http://www.uniprot.org/uniprot/Q00942 Q00942] | ||
+ | ** [http://www.uniprot.org/uniprot/P22447 P22447] | ||
+ | ** [http://www.uniprot.org/uniprot/P08096 P08096] | ||
+ | ** [http://www.uniprot.org/uniprot/P07065 P07065] | ||
+ | ** [http://www.uniprot.org/uniprot/P0AES4 P0AES4] | ||
+ | ** [http://www.uniprot.org/uniprot/P14829 P14829] | ||
+ | ** [http://www.uniprot.org/uniprot/P77993 P77993] | ||
+ | ** [http://www.uniprot.org/uniprot/P22840 P22840] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01320 Q01320] | ||
+ | ** [http://www.uniprot.org/uniprot/P15348 P15348] | ||
+ | ** [http://www.uniprot.org/uniprot/P13364 P13364] | ||
+ | ** [http://www.uniprot.org/uniprot/P34203 P34203] | ||
+ | ** [http://www.uniprot.org/uniprot/P50074 P50074] | ||
+ | ** [http://www.uniprot.org/uniprot/P34031 P34031] | ||
+ | ** [http://www.uniprot.org/uniprot/Q50404 Q50404] | ||
+ | ** [http://www.uniprot.org/uniprot/Q50405 Q50405] | ||
+ | ** [http://www.uniprot.org/uniprot/Q50406 Q50406] | ||
+ | ** [http://www.uniprot.org/uniprot/P41513 P41513] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43906 Q43906] | ||
+ | ** [http://www.uniprot.org/uniprot/P30182 P30182] | ||
+ | ** [http://www.uniprot.org/uniprot/P37411 P37411] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A0L0 P0A0L0] | ||
+ | ** [http://www.uniprot.org/uniprot/Q50435 Q50435] | ||
+ | ** [http://www.uniprot.org/uniprot/P22446 P22446] | ||
+ | ** [http://www.uniprot.org/uniprot/P77966 P77966] | ||
+ | ** [http://www.uniprot.org/uniprot/Q48974 Q48974] | ||
+ | ** [http://www.uniprot.org/uniprot/Q48995 Q48995] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49017 Q49017] | ||
+ | ** [http://www.uniprot.org/uniprot/O68071 O68071] | ||
+ | ** [http://www.uniprot.org/uniprot/O68140 O68140] | ||
+ | ** [http://www.uniprot.org/uniprot/O24308 O24308] | ||
+ | ** [http://www.uniprot.org/uniprot/Q57532 Q57532] | ||
+ | ** [http://www.uniprot.org/uniprot/O41065 O41065] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNN5 Q9ZNN5] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNN4 Q9ZNN4] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNN3 Q9ZNN3] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNN2 Q9ZNN2] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNN1 Q9ZNN1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNN0 Q9ZNN0] | ||
+ | ** [http://www.uniprot.org/uniprot/O87117 O87117] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9WXF4 Q9WXF4] | ||
+ | ** [http://www.uniprot.org/uniprot/O50627 O50627] | ||
+ | ** [http://www.uniprot.org/uniprot/O50628 O50628] | ||
+ | ** [http://www.uniprot.org/uniprot/P94604 P94604] | ||
+ | ** [http://www.uniprot.org/uniprot/P94605 P94605] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S5H9 Q9S5H9] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNH3 Q9ZNH3] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNH2 Q9ZNH2] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=dna_topoisomerase}} | ||
+ | {{#set: common name=ORF}} | ||
+ | {{#set: common name=dna_topoisomerase_6_subunit_a}} | ||
+ | {{#set: common name=dna_topoisomerase_2}} | ||
+ | {{#set: ec number=EC-5.99.1.3}} | ||
+ | {{#set: gene associated=Tiso_gene_828|Tiso_gene_3610|Tiso_gene_3374|Tiso_gene_12629|Tiso_gene_1291|Tiso_gene_3728|Tiso_gene_3396|Tiso_gene_6569|Tiso_gene_829}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:25, 21 March 2018
Contents
Reaction 5.99.1.3-RXN
- direction:
- REVERSIBLE
- common name:
- dna_topoisomerase
- ORF
- dna_topoisomerase_6_subunit_a
- dna_topoisomerase_2
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 Double-Stranded-DNAs[c] <=> 1 Pi[c] + 1 Negatively-super-coiled-DNAs[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 a double stranded DNA[c] <=> 1 phosphate[c] + 1 a negatively supercoiled DNA[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_828
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3610
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3374
- Source: orthology-esiliculosus
- Gene: Tiso_gene_12629
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1291
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3728
- Source: orthology-esiliculosus
- Gene: Tiso_gene_3396
- Source: orthology-esiliculosus
- Gene: Tiso_gene_6569
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_829
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- UNIPROT:
- Q7M3G2
- Q02880
- P0A0K8
- P41515
- P12531
- P27570
- Q03470
- P35810
- P43701
- Q9JX55
- Q9CH36
- P20831
- Q9JTW5
- P33769
- P47250
- Q59189
- P05652
- P43700
- P05653
- O87667
- Q9CGI5
- P23992
- P09176
- P06786
- P0AES6
- Q00942
- P22447
- P08096
- P07065
- P0AES4
- P14829
- P77993
- P22840
- Q01320
- P15348
- P13364
- P34203
- P50074
- P34031
- Q50404
- Q50405
- Q50406
- P41513
- Q43906
- P30182
- P37411
- P0A0L0
- Q50435
- P22446
- P77966
- Q48974
- Q48995
- Q49017
- O68071
- O68140
- O24308
- Q57532
- O41065
- Q9ZNN5
- Q9ZNN4
- Q9ZNN3
- Q9ZNN2
- Q9ZNN1
- Q9ZNN0
- O87117
- Q9WXF4
- O50627
- O50628
- P94604
- P94605
- Q9S5H9
- Q9ZNH3
- Q9ZNH2