Difference between revisions of "Tiso gene 8411"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DARABCAT-PWY DARABCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 T...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DARABCAT-PWY DARABCAT-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** D-arabinose degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** D-arabinose catabolism |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * | + | * '''1''' reaction(s) found |
− | * | + | ** [[D-RIBULOKIN-RXN]] |
− | * [[ | + | == Reaction(s) not found == |
− | == Reaction(s) | + | * '''1''' reaction(s) not found |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=DARABISOM-RXN DARABISOM-RXN] |
− | + | ||
− | * [ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=D-arabinose degradation II}} | |
− | + | {{#set: common name=D-arabinose catabolism}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:32, 10 January 2018
Pathway DARABCAT-PWY
- taxonomic range:
- common name:
- D-arabinose degradation II
- Synonym(s):
- D-arabinose catabolism
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found