Difference between revisions of "UBIQUINONE-8"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_7719 == * left end position: ** 2025 * transcription direction: ** POSITIVE * right end position: ** 5158 * centisome position: ** 18.62069...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_7719 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
* left end position:
+
* smiles:
** 2025
+
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
* right end position:
+
* common name:
** 5158
+
** 3-oxo-(7Z)-tetradecenoyl-CoA
* centisome position:
+
* molecular weight:
** 18.62069    
+
** 985.829    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-14:1-Δ7-CoA
 +
** 3-oxo-7-cis-tetradecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-15556]]
+
* [[RXN-17795]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-17794]]
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2025}}
+
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
{{#set: right end position=5158}}
+
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
{{#set: centisome position=18.62069   }}
+
{{#set: molecular weight=985.829   }}
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
{{#set: pathway associated=PWY-7511}}
+
{{#set: consumed by=RXN-17795}}
 +
{{#set: produced by=RXN-17794}}

Revision as of 16:34, 10 January 2018

Metabolite CPD-19157

  • smiles:
    • CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
  • common name:
    • 3-oxo-(7Z)-tetradecenoyl-CoA
  • molecular weight:
    • 985.829
  • Synonym(s):
    • 3-oxo-14:1-Δ7-CoA
    • 3-oxo-7-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.