Difference between revisions of "UBIQUINONE-8"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7719 == * left end position: ** 2025 * transcription direction: ** POSITIVE * right end position: ** 5158 * centisome position: ** 18.62069...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-(7Z)-tetradecenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 985.829 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-14:1-Δ7-CoA | ||
| + | ** 3-oxo-7-cis-tetradecenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-17795]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17794]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}} |
| − | {{#set: | + | {{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=985.829 }} |
| − | {{#set: | + | {{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17795}} |
| + | {{#set: produced by=RXN-17794}} | ||
Revision as of 15:34, 10 January 2018
Contents
Metabolite CPD-19157
- smiles:
- CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
- common name:
- 3-oxo-(7Z)-tetradecenoyl-CoA
- molecular weight:
- 985.829
- Synonym(s):
- 3-oxo-14:1-Δ7-CoA
- 3-oxo-7-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
