Difference between revisions of "Tiso gene 45"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11680 RXN-11680] == * direction: ** LEFT-TO-RIGHT * common name: ** Delta-6 fatty acid desatura...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11680 RXN-11680] ==
* smiles:
+
* direction:
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxydecanoyl-CoA
+
** Delta-6 fatty acid desaturase
* molecular weight:
+
* ec number:
** 933.753   
+
** [http://enzyme.expasy.org/EC/1.14.19.47 EC-1.14.19.47]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12490]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Linoleoyl-groups]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[Gamma-linolenoyl-groups]][c] '''+''' 2 [[WATER]][c]
* [[RXN-13616]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a [glycerolipid]-linoleate[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 oxygen[c] '''+''' 2 H+[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 1 a [glycerolipid]-γ-linolenate[c] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18205]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
* [[Tiso_gene_9580]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_7427]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_18056]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_8027]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5353]], arachidonate biosynthesis I (6-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-6603]], dicranin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6603 PWY-6603]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* LIGAND-RXN:
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07063 R07063]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
+
{{#set: common name=Delta-6 fatty acid desaturase}}
* BIGG : 3hdcoa
+
{{#set: ec number=EC-1.14.19.47}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_18205|Tiso_gene_9580|Tiso_gene_7427|Tiso_gene_18056|Tiso_gene_8027}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
+
{{#set: in pathway=PWY-5353|PWY-6603}}
* HMDB : HMDB03938
+
{{#set: reconstruction category=orthology}}
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
+
{{#set: reconstruction source=esiliculosus}}
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=933.753    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: consumed by=RXN-12490}}
+
{{#set: reconstruction source=in-silico_annotation}}
{{#set: produced by=RXN-13616}}
+

Revision as of 16:34, 10 January 2018

Reaction RXN-11680

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Delta-6 fatty acid desaturase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5353, arachidonate biosynthesis I (6-desaturase, lower eukaryotes): PWY-5353
    • 3 reactions found over 8 reactions in the full pathway
  • PWY-6603, dicranin biosynthesis: PWY-6603
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links