Difference between revisions of "Tiso gene 5765"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16913 == * left end position: ** 12 * transcription direction: ** POSITIVE * right end position: ** 2427 * centisome position: ** 0.2968827...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * smiles: ** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_16913 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] ==
−
* left end position:
+
* smiles:
−
** 12
+
** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
−
* right end position:
+
* common name:
−
** 2427
+
** N-acetyl-serotonin glucuronide
−
* centisome position:
+
* molecular weight:
−
** 0.29688272    
+
** 393.372    
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-5-hydroxytryptamine glucuronide
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15556]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-11060]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=12}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29971053 29971053]
−
{{#set: right end position=2427}}
+
{{#set: smiles=CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))}}
−
{{#set: centisome position=0.29688272   }}
+
{{#set: inchi key=InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M}}
−
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
{{#set: common name=N-acetyl-serotonin glucuronide}}
−
{{#set: pathway associated=PWY-7511}}
+
{{#set: molecular weight=393.372   }}
 +
{{#set: common name=N-acetyl-5-hydroxytryptamine glucuronide}}
 +
{{#set: produced by=RXN-11060}}

Revision as of 16:35, 10 January 2018

Metabolite CPD-12016

  • smiles:
    • CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
  • inchi key:
    • InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
  • common name:
    • N-acetyl-serotonin glucuronide
  • molecular weight:
    • 393.372
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5765&oldid=9681"