Difference between revisions of "Tiso gene 348"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6681 PWY-6681] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6681 PWY-6681] ==
−
* smiles:
+
* taxonomic range:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
−
* inchi key:
+
−
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
+
 
* common name:
 
* common name:
−
** gibberellin A12
+
** neurosporaxanthin biosynthesis
−
* molecular weight:
+
−
** 330.423   
+
 
* Synonym(s):
 
* Synonym(s):
−
** C20-GAs
 
−
** open lactone gibberrellin skeleton
 
−
** C20 skeleton
 
−
** C20-GA skeleton
 
−
** C20-gibberellin skeleton
 
−
** GA12
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN1F-162]]
+
* '''2''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[RXN-11989]]
−
* [[RXN1F-161]]
+
** [[RXN-11999]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''5''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11974 RXN-11974]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12001 RXN-12001]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11998 RXN-11998]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11976 RXN-11976]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12000 RXN-12000]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170014
+
{{#set: taxonomic range=TAX-33154}}
−
* PUBCHEM:
+
{{#set: common name=neurosporaxanthin biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
+
{{#set: reaction found=2}}
−
* CHEBI:
+
{{#set: reaction not found=5}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
+
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
+
−
{{#set: common name=gibberellin A12}}
+
−
{{#set: molecular weight=330.423    }}
+
−
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
+
−
{{#set: consumed by=RXN1F-162}}
+
−
{{#set: produced by=RXN1F-161}}
+

Revision as of 16:36, 10 January 2018

Pathway PWY-6681

  • taxonomic range:
  • common name:
    • neurosporaxanthin biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_348&oldid=9738"