Difference between revisions of "PWY-3722"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TROPINE-DEHYDROGENASE-RXN TROPINE-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE * ec number: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] == * smiles: ** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J |
+ | * common name: | ||
+ | ** (R)-3-hydroxyoctanoyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 905.7 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (R)-3-hydroxyoctanoyl-CoA | ||
+ | ** (3R)-3-hydroxyoctanoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14275]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14276]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173319 46173319] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74279 74279] |
− | {{#set: | + | * BIGG : 3hocoa |
− | {{#set: | + | {{#set: smiles=CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J}} |
− | {{#set: | + | {{#set: common name=(R)-3-hydroxyoctanoyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=905.7 }} |
− | {{#set: | + | {{#set: common name=(R)-3-hydroxyoctanoyl-CoA|(3R)-3-hydroxyoctanoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-14275}} |
+ | {{#set: produced by=RXN-14276}} |
Revision as of 15:37, 10 January 2018
Contents
Metabolite CPD-14916
- smiles:
- CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- inchi key:
- InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J
- common name:
- (R)-3-hydroxyoctanoyl-CoA
- molecular weight:
- 905.7
- Synonym(s):
- (R)-3-hydroxyoctanoyl-CoA
- (3R)-3-hydroxyoctanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.