Difference between revisions of "CPD-4581"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=M5TAP M5TAP] == * direction: ** LEFT-TO-RIGHT * common name: ** S-methyl-5'-thioadenosine phosphory...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=M5TAP M5TAP] ==
* smiles:
+
* direction:
** [CH](=O)C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
+
 
* common name:
 
* common name:
** aldehydo-L-arabinose
+
** S-methyl-5'-thioadenosine phosphorylase
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[Pi]][c] '''+''' 1.0 [[5-METHYLTHIOADENOSINE]][c] '''=>''' 1.0 [[ADENINE]][c] '''+''' 1.0 [[CPD-444]][c]
* [[RXN-14102]]
+
* With common name(s):
* [[RXN-14808]]
+
** 1.0 phosphate[c] '''+''' 1.0 S-methyl-5'-thioadenosine[c] '''=>''' 1.0 adenine[c] '''+''' 1.0 S-methyl-5-thio-α-D-ribose 1-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_20384]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291]
+
{{#set: common name=S-methyl-5'-thioadenosine phosphorylase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_20384}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476]
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: reconstruction source=creinhardtii}}
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}}
+
{{#set: common name=aldehydo-L-arabinose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: consumed or produced by=RXN-14102|RXN-14808}}
+

Revision as of 15:38, 10 January 2018

Reaction M5TAP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • S-methyl-5'-thioadenosine phosphorylase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 phosphate[c] + 1.0 S-methyl-5'-thioadenosine[c] => 1.0 adenine[c] + 1.0 S-methyl-5-thio-α-D-ribose 1-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links