|
|
Line 1: |
Line 1: |
− | [[Category:Gene]] | + | [[Category:Metabolite]] |
− | == Gene Tiso_gene_13083 == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == |
− | * left end position: | + | * smiles: |
− | ** 2216 | + | ** C(C1(=CC=CC(=C1O)O))([O-])=O |
− | * transcription direction: | + | * inchi key: |
− | ** POSITIVE | + | ** InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M |
− | * right end position: | + | * common name: |
− | ** 3632 | + | ** 2,3-dihydroxybenzoate |
− | * centisome position: | + | * molecular weight: |
− | ** 33.868256 | + | ** 153.114 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 2,3-dihydroxybenzoic acid |
| + | ** 3-hydroxysalicylate |
| + | ** catechol-3-carboxylate |
| + | ** 2-pyrocatechuate |
| | | |
− | == Reactions associated == | + | == Reaction(s) known to consume the compound == |
− | * [[2.3.1.41-RXN]]
| + | == Reaction(s) known to produce the compound == |
− | ** experimental_annotation
| + | * [[DHBDEHYD-RXN]] |
− | ***automated-name-match
| + | == Reaction(s) of unknown directionality == |
− | * [[3-OXOACYL-ACP-REDUCT-RXN]] | + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[PYRIDOXAL-4-DEHYDROGENASE-RXN]]
| + | |
− | ** experimental_annotation
| + | |
− | ***automated-name-match
| + | |
− | * [[RXN-10060]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-10655]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-10659]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-11476]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-11480]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-12994]]
| + | |
− | ** experimental_annotation
| + | |
− | ***automated-name-match
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-13008]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-13443]]
| + | |
− | ** experimental_annotation
| + | |
− | ***automated-name-match
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-16616]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | * [[RXN-16622]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | * [[RXN-16626]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | * [[RXN-16630]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | * [[RXN-9514]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9518]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9524]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9528]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9532]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9536]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9540]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9544]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9552]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9556]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN-9633]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN0-2142]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-1050]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-1053]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-1247]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-157]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-163]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-182]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-184]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-203]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-240]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-252]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-260]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-262]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-287]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-349]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-358]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-364]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-384]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-408]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-409]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-469]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-481]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-508]]
| + | |
− | ** in-silico_annotation
| + | |
− | ***ec-number
| + | |
− | ** experimental_annotation
| + | |
− | ***ec-number
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-613]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-617]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-637]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-717]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-72]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-853]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-881]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[RXN1G-951]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways associated == | + | |
− | * [[PWY-7388]]
| + | |
− | * [[PWY-5367]]
| + | |
− | * [[PWY-5972]]
| + | |
− | * [[PWY-5973]]
| + | |
− | * [[PWY-5971]]
| + | |
− | * [[PWY-5499]]
| + | |
− | * [[PWY0-862]]
| + | |
− | * [[PWY-7053]]
| + | |
− | * [[PWY-6113]]
| + | |
− | * [[PWY-7619]]
| + | |
− | * [[PWY-6282]]
| + | |
− | * [[PWY-5994]]
| + | |
− | * [[PWY3O-355]]
| + | |
− | * [[PWY-7724]]
| + | |
− | * [[PWY-7727]]
| + | |
− | * [[FASYN-ELONG-PWY]]
| + | |
− | * [[PWY-6519]]
| + | |
− | * [[PWY-7602]]
| + | |
− | * [[PWY-7606]]
| + | |
− | * [[PWY-5989]]
| + | |
− | * [[PWYG-321]]
| + | |
− | * [[PWY-7663]]
| + | |
− | * [[PWY-7664]]
| + | |
| == External links == | | == External links == |
− | {{#set: left end position=2216}} | + | * CAS : 303-38-8 |
− | {{#set: transcription direction=POSITIVE}} | + | * PUBCHEM: |
− | {{#set: right end position=3632}} | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675818 54675818] |
− | {{#set: centisome position=33.868256 }} | + | * HMDB : HMDB00397 |
− | {{#set: reaction associated=2.3.1.41-RXN|3-OXOACYL-ACP-REDUCT-RXN|PYRIDOXAL-4-DEHYDROGENASE-RXN|RXN-10060|RXN-10655|RXN-10659|RXN-11476|RXN-11480|RXN-12994|RXN-13008|RXN-13443|RXN-16616|RXN-16622|RXN-16626|RXN-16630|RXN-9514|RXN-9518|RXN-9524|RXN-9528|RXN-9532|RXN-9536|RXN-9540|RXN-9544|RXN-9552|RXN-9556|RXN-9633|RXN0-2142|RXN1G-1050|RXN1G-1053|RXN1G-1247|RXN1G-157|RXN1G-163|RXN1G-182|RXN1G-184|RXN1G-203|RXN1G-240|RXN1G-252|RXN1G-260|RXN1G-262|RXN1G-287|RXN1G-349|RXN1G-358|RXN1G-364|RXN1G-384|RXN1G-408|RXN1G-409|RXN1G-469|RXN1G-481|RXN1G-508|RXN1G-613|RXN1G-617|RXN1G-637|RXN1G-717|RXN1G-72|RXN1G-853|RXN1G-881|RXN1G-951}} | + | * LIGAND-CPD: |
− | {{#set: pathway associated=PWY-7388|PWY-5367|PWY-5972|PWY-5973|PWY-5971|PWY-5499|PWY0-862|PWY-7053|PWY-6113|PWY-7619|PWY-6282|PWY-5994|PWY3O-355|PWY-7724|PWY-7727|FASYN-ELONG-PWY|PWY-6519|PWY-7602|PWY-7606|PWY-5989|PWYG-321|PWY-7663|PWY-7664}} | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00196 C00196] |
| + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.5323089.html 5323089] |
| + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36654 36654] |
| + | * BIGG : 23dhb |
| + | {{#set: smiles=C(C1(=CC=CC(=C1O)O))([O-])=O}} |
| + | {{#set: inchi key=InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M}} |
| + | {{#set: common name=2,3-dihydroxybenzoate}} |
| + | {{#set: molecular weight=153.114 }} |
| + | {{#set: common name=2,3-dihydroxybenzoic acid|3-hydroxysalicylate|catechol-3-carboxylate|2-pyrocatechuate}} |
| + | {{#set: produced by=DHBDEHYD-RXN}} |