Difference between revisions of "CPD-12177"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-21...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * common name: ** (R)-methylmalonate-s...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-2191]
+
** CC([CH]=O)C(=O)[O-]
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-94695 TAX-94695]
+
 
* common name:
 
* common name:
** coenzyme M biosynthesis II
+
** (R)-methylmalonate-semialdehyde
 +
* inchi key:
 +
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
 +
* molecular weight:
 +
** 101.082   
 
* Synonym(s):
 
* Synonym(s):
** CoM biosynthesis II
+
** (R)-2-methyl-3-oxopropanoate
 +
** (R)-ch3-malonate-semialdehyde
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[RXN-11737]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [[RXN-14056]]
* '''5''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=R233-RXN R233-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=R232-RXN R232-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11108 RXN-11108]
+
** [http://metacyc.org/META/NEW-IMAGE?object=R234-RXN R234-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=R231-RXN R231-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2191}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-94695}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
{{#set: common name=coenzyme M biosynthesis II}}
+
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
{{#set: common name=CoM biosynthesis II}}
+
{{#set: common name=(R)-methylmalonate-semialdehyde}}
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
{{#set: reaction not found=5}}
+
{{#set: molecular weight=101.082    }}
 +
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
 +
{{#set: reversible reaction associated=RXN-14056}}

Latest revision as of 20:09, 21 March 2018

Metabolite CPD-12177

  • smiles:
    • CC([CH]=O)C(=O)[O-]
  • common name:
    • (R)-methylmalonate-semialdehyde
  • inchi key:
    • InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
  • molecular weight:
    • 101.082
  • Synonym(s):
    • (R)-2-methyl-3-oxopropanoate
    • (R)-ch3-malonate-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.