Difference between revisions of "RXN-16561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16561 RXN-16561] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16561 RXN-16561] ==
* smiles:
+
* direction:
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
+
** [http://enzyme.expasy.org/EC/2.3.1.155 EC-2.3.1.155]
* common name:
+
** gibberellin A15 (open lactone form)
+
* molecular weight:
+
** 346.422   
+
 
* Synonym(s):
 
* Synonym(s):
** gibberellin A15
 
** GA15
 
** GA15 (open lactone form)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN1F-163]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17815]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-17464]][c]
* [[RXN1F-162]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 (11Z)-3-oxo-hexadecenoyl-CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 (9Z)-tetradecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
 +
** '''6''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170017
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.155}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
+
{{#set: in pathway=PWY-7656}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
+
{{#set: common name=gibberellin A15 (open lactone form)}}
+
{{#set: molecular weight=346.422    }}
+
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
+
{{#set: consumed by=RXN1F-163}}
+
{{#set: produced by=RXN1F-162}}
+

Latest revision as of 19:09, 21 March 2018

Reaction RXN-16561

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (11Z)-3-oxo-hexadecenoyl-CoA[c] + 1 coenzyme A[c] => 1 acetyl-CoA[c] + 1 (9Z)-tetradecenoyl-CoA[c]

Genes associated with this reaction

Pathways

  • PWY-7656, Spodoptera littoralis pheromone biosynthesis: PWY-7656
    • 6 reactions found over 22 reactions in the full pathway

Reconstruction information

External links