Difference between revisions of "PWY-6987"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6987 PWY-6987] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6987 PWY-6987] ==
−
* smiles:
+
* taxonomic range:
−
** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
+
 
* common name:
 
* common name:
−
** cob(I)yrinate a,c-diamide
+
** lipoate biosynthesis and incorporation III (Bacillus)
−
* molecular weight:
+
−
** 931.9   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cob(I)yrinic acid a,c-diamide
 
−
** Cob(I)yrinate diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[R344-RXN]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-13037]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_4494]]
 +
*** [[Tiso_gene_4493]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN0-949]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8049]]
 +
*** [[Tiso_gene_437]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13036 RXN-13036]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689]
+
{{#set: common name=lipoate biosynthesis and incorporation III (Bacillus)}}
−
* CHEBI:
+
{{#set: reaction found=2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575]
+
{{#set: total reaction=3}}
−
* LIGAND-CPD:
+
{{#set: completion rate=67.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505]
+
−
* HMDB : HMDB06904
+
−
{{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}}
+
−
{{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}}
+
−
{{#set: common name=cob(I)yrinate a,c-diamide}}
+
−
{{#set: molecular weight=931.9    }}
+
−
{{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}}
+
−
{{#set: consumed by=R344-RXN}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-6987

  • taxonomic range:
  • common name:
    • lipoate biosynthesis and incorporation III (Bacillus)
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6987&oldid=39912"