Difference between revisions of "CPD1F-131"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16094 RXN-16094] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16094 RXN-16094] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199]
+
** antheraxanthin
 +
* inchi key:
 +
** InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N
 +
* molecular weight:
 +
** 584.881   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7985]]
−
** 1 [[CPD-18]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17346]][c]
+
* [[RXN-7979]]
−
* With common name(s):
+
* [[ANXANor]]
−
** 1 linoleoyl-CoA[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 coenzyme A[c] '''+''' 1 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA[c]
+
== Reaction(s) known to produce the compound ==
−
 
+
* [[RXN-7978]]
−
== Genes associated with this reaction  ==
+
* [[RXN-7984]]
−
== Pathways  ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-7601]], arachidonate biosynthesis IV (8-detaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7601 PWY-7601]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7725]], arachidonate biosynthesis V (8-detaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6598]], sciadonate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6598 PWY-6598]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.199}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244322 25244322]
−
{{#set: in pathway=PWY-7601|PWY-7725|PWY-6598}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27867 27867]
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08579 C08579]
 +
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C}}
 +
{{#set: common name=antheraxanthin}}
 +
{{#set: inchi key=InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N}}
 +
{{#set: molecular weight=584.881    }}
 +
{{#set: consumed by=RXN-7985|RXN-7979|ANXANor}}
 +
{{#set: produced by=RXN-7978|RXN-7984}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD1F-131

  • smiles:
    • CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C
  • common name:
    • antheraxanthin
  • inchi key:
    • InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N
  • molecular weight:
    • 584.881
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-131&oldid=39935"