Difference between revisions of "RXN-15733"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] == * direction: ** LEFT-TO-RIGHT * common name: ** folic_acid_synthesis_protei...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** folic_acid_synthesis_protein |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.6.3 EC-2.7.6.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[ATP]][c] '''+''' 1 [[CPD-16953]][c] '''=>''' 1 [[CPD-16954]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin[c] '''=>''' 1 [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 H+[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11659]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6148]], tetrahydromethanopterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6148 PWY-6148] | ||
+ | ** '''2''' reactions found over '''14''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=folic_acid_synthesis_protein}} | |
− | + | {{#set: ec number=EC-2.7.6.3}} | |
− | + | {{#set: gene associated=Tiso_gene_11659}} | |
− | + | {{#set: in pathway=PWY-6148}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:10, 21 March 2018
Contents
Reaction RXN-15733
- direction:
- LEFT-TO-RIGHT
- common name:
- folic_acid_synthesis_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin[c] => 1 [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate[c] + 1 AMP[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11659
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-6148, tetrahydromethanopterin biosynthesis: PWY-6148
- 2 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation