Difference between revisions of "CPD-8607"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10587 CPD-10587] == * smiles: ** CC([CH]=O)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == |
* smiles: | * smiles: | ||
| − | ** CC([CH] | + | ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol |
| + | * inchi key: | ||
| + | ** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 444.74 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-12]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-11]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698821 15698821] |
| − | * HMDB : | + | * CHEBI: |
| − | {{#set: smiles=CC([CH] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87057 87057] |
| − | + | * HMDB : HMDB12160 | |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} |
| − | {{#set: molecular weight= | + | {{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}} |
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}} |
| − | {{#set: produced by= | + | {{#set: molecular weight=444.74 }} |
| + | {{#set: consumed by=RXN66-12}} | ||
| + | {{#set: produced by=RXN66-11}} | ||
Latest revision as of 19:13, 21 March 2018
Contents
Metabolite CPD-8607
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- common name:
- 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
- inchi key:
- InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
- molecular weight:
- 444.74
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
