Difference between revisions of "CPD-1086"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-SYN2-PWY GLYCINE-SYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * co...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-SYN2-PWY GLYCINE-SYN2-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
+
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
 
* common name:
 
* common name:
** glycine biosynthesis II
+
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
 +
* inchi key:
 +
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
 +
* molecular weight:
 +
** 354.213   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-amino-6-(5'-phosphoribitylamino)uracil
 +
** 5-amino-6-(5-phosphoribitylamino)uracil
 +
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[GLYCLEAV-PWY]]
+
* [[RXN-10058]]
** [[GCVP-RXN]]
+
* [[RIBOFLAVINSYNREDUC-RXN]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33154}}
+
* LIGAND-CPD:
{{#set: common name=glycine biosynthesis II}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
{{#set: reaction found=2}}
+
* HMDB : HMDB03841
{{#set: reaction not found=0}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
 +
* BIGG : 5aprbu
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
 +
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
 +
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
 +
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
 +
{{#set: molecular weight=354.213    }}
 +
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
 +
{{#set: produced by=RXN-10058|RIBOFLAVINSYNREDUC-RXN}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD-1086

  • smiles:
    • C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
  • common name:
    • 5-amino-6-(5-phospho-D-ribitylamino)uracil
  • inchi key:
    • InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
  • molecular weight:
    • 354.213
  • Synonym(s):
    • 5-amino-6-(5'-phosphoribitylamino)uracil
    • 5-amino-6-(5-phosphoribitylamino)uracil
    • 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.