Difference between revisions of "CPD-4125"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5483 == * left end position: ** 8781 * transcription direction: ** POSITIVE * right end position: ** 13241 * centisome position: ** 65.7260...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5483 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
* left end position:
+
* smiles:
** 8781
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* common name:
** POSITIVE
+
** avenasterol
* right end position:
+
* inchi key:
** 13241
+
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
* centisome position:
+
* molecular weight:
** 65.72605    
+
** 412.698    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ADENYLATECYC-RXN]]
+
* [[RXN-4209]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=8781}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736]
{{#set: right end position=13241}}
+
* HMDB : HMDB06851
{{#set: centisome position=65.72605   }}
+
* LIGAND-CPD:
{{#set: reaction associated=ADENYLATECYC-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
 +
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=avenasterol}}
 +
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
 +
{{#set: molecular weight=412.698   }}
 +
{{#set: consumed by=RXN-4209}}

Latest revision as of 19:11, 21 March 2018

Metabolite CPD-4125

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • avenasterol
  • inchi key:
    • InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.