Difference between revisions of "2K-ADIPATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19083 == * left end position: ** 656 * transcription direction: ** POSITIVE * right end position: ** 2537 * centisome position: ** 25.27938...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * common name: ** 2-oxoadip...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(CC(=O)C(=O)[O-])CC(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** 2-oxoadipate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 158.11 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-ketoadipate | ||
+ | ** α-ketoadipate | ||
+ | ** 2-keto-adipate | ||
+ | ** 2-oxohexanedionic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2-KETO-ADIPATE-DEHYDROG-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]] | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 3184-35-8 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615192 23615192] |
− | {{#set: | + | * HMDB : HMDB00225 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00322 C00322] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19951093.html 19951093] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57499 57499] | ||
+ | * METABOLIGHTS : MTBLC57499 | ||
+ | {{#set: smiles=C(CC(=O)C(=O)[O-])CC(=O)[O-]}} | ||
+ | {{#set: common name=2-oxoadipate}} | ||
+ | {{#set: inchi key=InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L}} | ||
+ | {{#set: molecular weight=158.11 }} | ||
+ | {{#set: common name=2-ketoadipate|α-ketoadipate|2-keto-adipate|2-oxohexanedionic acid}} | ||
+ | {{#set: consumed by=2-KETO-ADIPATE-DEHYDROG-RXN}} | ||
+ | {{#set: reversible reaction associated=2-AMINOADIPATE-AMINOTRANSFERASE-RXN}} |
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite 2K-ADIPATE
- smiles:
- C(CC(=O)C(=O)[O-])CC(=O)[O-]
- common name:
- 2-oxoadipate
- inchi key:
- InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L
- molecular weight:
- 158.11
- Synonym(s):
- 2-ketoadipate
- α-ketoadipate
- 2-keto-adipate
- 2-oxohexanedionic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 3184-35-8
- PUBCHEM:
- HMDB : HMDB00225
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57499
"C(CC(=O)C(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.