Difference between revisions of "TRNA-2-thiouridine34"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-2-thiouridine34 tRNA-2-thiouridine34] == * common name: ** a 2-thiouridine34 in tRNA * Syn...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-2-thiouridine34 tRNA-2-thiouridine34] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 2-thiouridine34 in tRNA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a tRNA 2-thiouridine34 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN0-2023]] | |
− | * [[RXN0- | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a 2-thiouridine34 in tRNA}} | |
− | + | {{#set: common name=a tRNA 2-thiouridine34}} | |
− | + | {{#set: produced by=RXN0-2023}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: produced by= | + | |
− | + |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite tRNA-2-thiouridine34
- common name:
- a 2-thiouridine34 in tRNA
- Synonym(s):
- a tRNA 2-thiouridine34