Difference between revisions of "Tiso gene 3322"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_3322 == * right end position: ** 7070 * transcription direction: ** POSITIVE * left end position: ** 4552 * centisome position: ** 26.74186...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3322 == |
− | * | + | * right end position: |
− | ** | + | ** 7070 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4552 |
− | * | + | * centisome position: |
− | ** | + | ** 26.741863 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[13-BETA-GLUCAN-SYNTHASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-6773]] | |
== External links == | == External links == | ||
− | + | {{#set: right end position=7070}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4552}} | |
− | + | {{#set: centisome position=26.741863 }} | |
− | + | {{#set: reaction associated=13-BETA-GLUCAN-SYNTHASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-6773}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:14, 21 March 2018
Gene Tiso_gene_3322
- right end position:
- 7070
- transcription direction:
- POSITIVE
- left end position:
- 4552
- centisome position:
- 26.741863
- Synonym(s):
Reactions associated
- Reaction: 13-BETA-GLUCAN-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation