Difference between revisions of "Tiso gene 7682"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
(Created page with "Category:Gene == Gene Tiso_gene_7682 == * right end position: ** 10904 * transcription direction: ** POSITIVE * left end position: ** 9294 * centisome position: ** 85.1722...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7682 == |
− | * | + | * right end position: |
− | ** | + | ** 10904 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 9294 |
− | * | + | * centisome position: |
− | ** | + | ** 85.17229 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RIBOKIN-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14223]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[RIBOKIN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=10904}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=9294}} | |
− | + | {{#set: centisome position=85.17229 }} | |
− | + | {{#set: reaction associated=RIBOKIN-RXN|RXN-14223}} | |
− | + | {{#set: pathway associated=RIBOKIN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Gene Tiso_gene_7682
- right end position:
- 10904
- transcription direction:
- POSITIVE
- left end position:
- 9294
- centisome position:
- 85.17229
- Synonym(s):
Reactions associated
- Reaction: RIBOKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-14223
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation