Difference between revisions of "PWY-5538"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5538 PWY-5538] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5538 PWY-5538] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5719 TAX-5719]
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** pyruvate fermentation to acetate VI
* molecular weight:
+
** 444.74   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** acetate fermentation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-12]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[SUCCCOASYN-RXN]]
* [[RXN66-11]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_15846]]
 +
*** [[Tiso_gene_11866]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5536 PWY-5536]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5536 PWY-5536]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698821 15698821]
+
{{#set: taxonomic range=TAX-5719}}
* CHEBI:
+
{{#set: common name=pyruvate fermentation to acetate VI}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87057 87057]
+
{{#set: common name=acetate fermentation}}
* HMDB : HMDB12160
+
{{#set: reaction found=1}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: total reaction=4}}
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
+
{{#set: completion rate=25.0}}
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=444.74    }}
+
{{#set: consumed by=RXN66-12}}
+
{{#set: produced by=RXN66-11}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-5538

  • taxonomic range:
  • common name:
    • pyruvate fermentation to acetate VI
  • Synonym(s):
    • acetate fermentation

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links