Difference between revisions of "CPD-11404"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_3016 == * Synonym(s): == Reactions associated == * GLY3KIN-RXN ** pantograph-esiliculosus ** pantograph-creinhardtii *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * co...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_3016 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
 +
* smiles:
 +
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
 +
* common name:
 +
** 3,3',5-triiodothyroacetate
 +
* inchi key:
 +
** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 620.928   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,3',5-triiodothyroacetic acid
 +
** Triac
 +
** Tiratricol
 +
** Tiracana
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLY3KIN-RXN]]
+
* [[RXN-10618]]
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-10619]]
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-181]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GLY3KIN-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-181}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972]
 +
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}}
 +
{{#set: common name=3,3',5-triiodothyroacetate}}
 +
{{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=620.928    }}
 +
{{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}}
 +
{{#set: consumed by=RXN-10618|RXN-10619}}

Latest revision as of 19:14, 21 March 2018

Metabolite CPD-11404

  • smiles:
    • C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
  • common name:
    • 3,3',5-triiodothyroacetate
  • inchi key:
    • InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
  • molecular weight:
    • 620.928
  • Synonym(s):
    • 3,3',5-triiodothyroacetic acid
    • Triac
    • Tiratricol
    • Tiracana

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))" cannot be used as a page name in this wiki.