Difference between revisions of "Tiso gene 9871"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * inchi key: ** InChIKey=FSQQTNAZHBEJ...")
(Created page with "Category:Gene == Gene Tiso_gene_9871 == * right end position: ** 5930 * transcription direction: ** NEGATIVE * left end position: ** 4369 * centisome position: ** 48.53366...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] ==
+
== Gene Tiso_gene_9871 ==
−
* smiles:
+
* right end position:
−
** C(=CC(=O)[O-])C(N)=O
+
** 5930
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** maleamate
+
** 4369
−
* molecular weight:
+
* centisome position:
−
** 114.08    
+
** 48.53366    
 
* Synonym(s):
 
* Synonym(s):
−
** maleic acid monoamide
 
−
** maleamic acid
 
−
** (Z)-4-amino-4-oxo-but-2-enoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-646]]
+
* Reaction: [[RXN-12968]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12994]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13298]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13299]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13300]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13301]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13443]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14484]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14493]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16020]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16095]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16112]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16129]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16154]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17109]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7698]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7053]]
 +
* [[PWY-5353]]
 +
* [[PWY-7619]]
 +
* [[PWY-6433]]
 +
* [[PWY-7602]]
 +
* [[PWY-7049]]
 +
* [[PWY-7601]]
 +
* [[PWY-7606]]
 +
* [[PWY-6958]]
 +
* [[PWY-7728]]
 +
* [[PWY-6598]]
 +
* [[PWY-7036]]
 +
* [[PWY-7592]]
 +
* [[PWY-5080]]
 +
* [[PWY-7725]]
 +
* [[PWY-7724]]
 +
* [[PWY-7727]]
 +
* [[PWY-7726]]
 
== External links  ==
 
== External links  ==
−
* CAS : 557-24-4
+
{{#set: right end position=5930}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391]
+
{{#set: left end position=4369}}
−
* CHEMSPIDER:
+
{{#set: centisome position=48.53366   }}
−
** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932]
+
{{#set: reaction associated=RXN-12968|RXN-12994|RXN-13298|RXN-13299|RXN-13300|RXN-13301|RXN-13443|RXN-14484|RXN-14493|RXN-16020|RXN-16095|RXN-16112|RXN-16129|RXN-16154|RXN-17109|RXN-7698}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-7053|PWY-5353|PWY-7619|PWY-6433|PWY-7602|PWY-7049|PWY-7601|PWY-7606|PWY-6958|PWY-7728|PWY-6598|PWY-7036|PWY-7592|PWY-5080|PWY-7725|PWY-7724|PWY-7727|PWY-7726}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596]
+
−
{{#set: smiles=C(=CC(=O)[O-])C(N)=O}}
+
−
{{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}}
+
−
{{#set: common name=maleamate}}
+
−
{{#set: molecular weight=114.08   }}
+
−
{{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}}
+
−
{{#set: consumed by=RXN-646}}
+

Latest revision as of 19:14, 21 March 2018

Gene Tiso_gene_9871

  • right end position:
    • 5930
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4369
  • centisome position:
    • 48.53366
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9871&oldid=40369"