Difference between revisions of "PWY-7198"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * inchi key: ** InChIKey=WBYWAXJHA...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7198 PWY-7198] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7198 PWY-7198] ==
* smiles:
+
* taxonomic range:
** C(=O)([O-])C=CC1(=CC=CC=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M
+
 
* common name:
 
* common name:
** trans-cinnamate
+
** pyrimidine deoxyribonucleotides de novo biosynthesis IV
* molecular weight:
+
** 147.153   
+
 
* Synonym(s):
 
* Synonym(s):
** β-phenylacrylic acid
 
** 3-phenyl-2-propenoic acid
 
** cinnamic acid
 
** cinnamate
 
** trans-cinnamic acid
 
** (E)-cinnamate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-2001]]
+
'''6''' reactions found over '''7''' reactions in the full pathway
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
+
* [[CDPREDUCT-RXN]]
== Reaction(s) known to produce the compound ==
+
** 4 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_10617]]
 +
*** [[Tiso_gene_9916]]
 +
*** [[Tiso_gene_9915]]
 +
*** [[Tiso_gene_10138]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[DCDPKIN-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_9290]]
 +
*** [[Tiso_gene_17271]]
 +
*** [[Tiso_gene_17272]]
 +
*** [[Tiso_gene_195]]
 +
*** [[Tiso_gene_18224]]
 +
*** [[Tiso_gene_16529]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[DTDPKIN-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_18224]]
 +
*** [[Tiso_gene_16529]]
 +
*** [[Tiso_gene_195]]
 +
*** [[Tiso_gene_17271]]
 +
*** [[Tiso_gene_17272]]
 +
*** [[Tiso_gene_9290]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3755]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-12195]]
 +
** 101 associated gene(s):
 +
*** [[Tiso_gene_1960]]
 +
*** [[Tiso_gene_11098]]
 +
*** [[Tiso_gene_12899]]
 +
*** [[Tiso_gene_2924]]
 +
*** [[Tiso_gene_14226]]
 +
*** [[Tiso_gene_674]]
 +
*** [[Tiso_gene_8601]]
 +
*** [[Tiso_gene_8584]]
 +
*** [[Tiso_gene_9959]]
 +
*** [[Tiso_gene_2929]]
 +
*** [[Tiso_gene_9423]]
 +
*** [[Tiso_gene_873]]
 +
*** [[Tiso_gene_8763]]
 +
*** [[Tiso_gene_9004]]
 +
*** [[Tiso_gene_14816]]
 +
*** [[Tiso_gene_5529]]
 +
*** [[Tiso_gene_4192]]
 +
*** [[Tiso_gene_8859]]
 +
*** [[Tiso_gene_14227]]
 +
*** [[Tiso_gene_9234]]
 +
*** [[Tiso_gene_38]]
 +
*** [[Tiso_gene_2889]]
 +
*** [[Tiso_gene_4194]]
 +
*** [[Tiso_gene_15043]]
 +
*** [[Tiso_gene_537]]
 +
*** [[Tiso_gene_4026]]
 +
*** [[Tiso_gene_14646]]
 +
*** [[Tiso_gene_195]]
 +
*** [[Tiso_gene_3653]]
 +
*** [[Tiso_gene_1444]]
 +
*** [[Tiso_gene_8949]]
 +
*** [[Tiso_gene_17616]]
 +
*** [[Tiso_gene_546]]
 +
*** [[Tiso_gene_13738]]
 +
*** [[Tiso_gene_538]]
 +
*** [[Tiso_gene_2449]]
 +
*** [[Tiso_gene_1959]]
 +
*** [[Tiso_gene_7387]]
 +
*** [[Tiso_gene_2447]]
 +
*** [[Tiso_gene_20353]]
 +
*** [[Tiso_gene_5166]]
 +
*** [[Tiso_gene_4596]]
 +
*** [[Tiso_gene_2448]]
 +
*** [[Tiso_gene_5525]]
 +
*** [[Tiso_gene_12148]]
 +
*** [[Tiso_gene_20327]]
 +
*** [[Tiso_gene_11012]]
 +
*** [[Tiso_gene_2176]]
 +
*** [[Tiso_gene_13325]]
 +
*** [[Tiso_gene_13268]]
 +
*** [[Tiso_gene_12149]]
 +
*** [[Tiso_gene_2451]]
 +
*** [[Tiso_gene_6614]]
 +
*** [[Tiso_gene_2897]]
 +
*** [[Tiso_gene_4436]]
 +
*** [[Tiso_gene_623]]
 +
*** [[Tiso_gene_9926]]
 +
*** [[Tiso_gene_6181]]
 +
*** [[Tiso_gene_16478]]
 +
*** [[Tiso_gene_6180]]
 +
*** [[Tiso_gene_1984]]
 +
*** [[Tiso_gene_2452]]
 +
*** [[Tiso_gene_15465]]
 +
*** [[Tiso_gene_4092]]
 +
*** [[Tiso_gene_7745]]
 +
*** [[Tiso_gene_829]]
 +
*** [[Tiso_gene_250]]
 +
*** [[Tiso_gene_1541]]
 +
*** [[Tiso_gene_199]]
 +
*** [[Tiso_gene_7123]]
 +
*** [[Tiso_gene_10282]]
 +
*** [[Tiso_gene_9114]]
 +
*** [[Tiso_gene_2450]]
 +
*** [[Tiso_gene_14474]]
 +
*** [[Tiso_gene_8461]]
 +
*** [[Tiso_gene_4437]]
 +
*** [[Tiso_gene_4726]]
 +
*** [[Tiso_gene_9659]]
 +
*** [[Tiso_gene_8950]]
 +
*** [[Tiso_gene_2068]]
 +
*** [[Tiso_gene_9243]]
 +
*** [[Tiso_gene_13264]]
 +
*** [[Tiso_gene_4330]]
 +
*** [[Tiso_gene_13681]]
 +
*** [[Tiso_gene_1610]]
 +
*** [[Tiso_gene_13653]]
 +
*** [[Tiso_gene_17449]]
 +
*** [[Tiso_gene_10221]]
 +
*** [[Tiso_gene_19098]]
 +
*** [[Tiso_gene_4155]]
 +
*** [[Tiso_gene_8164]]
 +
*** [[Tiso_gene_19350]]
 +
*** [[Tiso_gene_2631]]
 +
*** [[Tiso_gene_17751]]
 +
*** [[Tiso_gene_1611]]
 +
*** [[Tiso_gene_3287]]
 +
*** [[Tiso_gene_7734]]
 +
*** [[Tiso_gene_572]]
 +
*** [[Tiso_gene_1291]]
 +
*** [[Tiso_gene_14239]]
 +
*** [[Tiso_gene_8860]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[THYMIDYLATESYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_7708]]
 +
*** [[Tiso_gene_18478]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.5.4.30-RXN 3.5.4.30-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 140-10-3
+
{{#set: taxonomic range=TAX-2157}}
* METABOLIGHTS : MTBLC15669
+
{{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis IV}}
* PUBCHEM:
+
{{#set: reaction found=6}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5957728 5957728]
+
{{#set: total reaction=7}}
* HMDB : HMDB00930
+
{{#set: completion rate=86.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00423 C00423]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4762929.html 4762929]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15669 15669]
+
* BIGG : cinnm
+
{{#set: smiles=C(=O)([O-])C=CC1(=CC=CC=C1)}}
+
{{#set: inchi key=InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M}}
+
{{#set: common name=trans-cinnamate}}
+
{{#set: molecular weight=147.153    }}
+
{{#set: common name=β-phenylacrylic acid|3-phenyl-2-propenoic acid|cinnamic acid|cinnamate|trans-cinnamic acid|(E)-cinnamate}}
+
{{#set: consumed by=RXN-2001|TRANS-CINNAMATE-4-MONOOXYGENASE-RXN}}
+

Latest revision as of 19:14, 21 March 2018

Pathway PWY-7198

  • taxonomic range:
  • common name:
    • pyrimidine deoxyribonucleotides de novo biosynthesis IV
  • Synonym(s):

Reaction(s) found

6 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links