Difference between revisions of "PWY-7315"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7315 PWY-7315] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7315 PWY-7315] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dTDP-N-acetylthomosamine biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 4- | + | ** dTDP-4-acetamido-α-D-fucose biosynthesis |
| + | ** dTDP-4-acetamido-4,6-dideoxy-α-D-galactose biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_7329]] | ||
| + | *** [[Tiso_gene_12394]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[DTDPGLUCOSEPP-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_14704]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RFFTRANS-RXN RFFTRANS-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=TDPFUCACTRANS-RXN TDPFUCACTRANS-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7315 PWY-7315] |
| − | {{#set: | + | {{#set: taxonomic range=TAX-1224}} |
| − | {{#set: | + | {{#set: common name=dTDP-N-acetylthomosamine biosynthesis}} |
| − | {{#set: common name=4- | + | {{#set: common name=dTDP-4-acetamido-α-D-fucose biosynthesis|dTDP-4-acetamido-4,6-dideoxy-α-D-galactose biosynthesis}} |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: | + | {{#set: total reaction=4}} |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
Latest revision as of 19:14, 21 March 2018
Pathway PWY-7315
- taxonomic range:
- common name:
- dTDP-N-acetylthomosamine biosynthesis
- Synonym(s):
- dTDP-4-acetamido-α-D-fucose biosynthesis
- dTDP-4-acetamido-4,6-dideoxy-α-D-galactose biosynthesis
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- DTDPGLUCDEHYDRAT-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- DTDPGLUCOSEPP-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
