Difference between revisions of "Tiso gene 18518"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * in...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18518 == * right end position: ** 1401 * transcription direction: ** POSITIVE * left end position: ** 34 * centisome position: ** 1.1451668...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
+
== Gene Tiso_gene_18518 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
+
** 1401
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3,3',5-triiodothyroacetate
+
** 34
−
* molecular weight:
+
* centisome position:
−
** 620.928    
+
** 1.1451668    
 
* Synonym(s):
 
* Synonym(s):
−
** 3,3',5-triiodothyroacetic acid
 
−
** Triac
 
−
** Tiratricol
 
−
** Tiracana
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10618]]
+
* Reaction: [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]]
−
* [[RXN-10619]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-5129]]
 +
* [[PWY3DJ-12]]
 +
* [[SPHINGOLIPID-SYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1401}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=34}}
−
** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972]
+
{{#set: centisome position=1.1451668   }}
−
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}}
+
{{#set: reaction associated=3-DEHYDROSPHINGANINE-REDUCTASE-RXN}}
−
{{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}}
+
{{#set: pathway associated=PWY-5129|PWY3DJ-12|SPHINGOLIPID-SYN-PWY}}
−
{{#set: common name=3,3',5-triiodothyroacetate}}
+
−
{{#set: molecular weight=620.928   }}
+
−
{{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}}
+
−
{{#set: consumed by=RXN-10618|RXN-10619}}
+

Latest revision as of 19:14, 21 March 2018

Gene Tiso_gene_18518

  • right end position:
    • 1401
  • transcription direction:
    • POSITIVE
  • left end position:
    • 34
  • centisome position:
    • 1.1451668
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18518&oldid=40323"