Difference between revisions of "PWY-7269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7269 PWY-7269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7269 PWY-7269] ==
* smiles:
+
* taxonomic range:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N
+
 
* common name:
 
* common name:
** castasterone
+
** NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast)
* molecular weight:
+
** 464.684   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''5''' reactions in the full pathway
* [[RXN-779]]
+
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_7322]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[ALDHDEHYDROG-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_7322]]
 +
*** [[Tiso_gene_3513]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[NAD-KIN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_1163]]
 +
*** [[Tiso_gene_14560]]
 +
*** [[Tiso_gene_1420]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN0-5330]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18172]]
 +
*** [[Tiso_gene_18831]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=NADH-KINASE-RXN NADH-KINASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=133534 133534]
+
{{#set: common name=NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast)}}
* CHEBI:
+
{{#set: reaction found=4}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23051 23051]
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=80.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C15794 C15794]
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N}}
+
{{#set: common name=castasterone}}
+
{{#set: molecular weight=464.684    }}
+
{{#set: produced by=RXN-779}}
+

Latest revision as of 19:15, 21 March 2018

Pathway PWY-7269

  • taxonomic range:
  • common name:
    • NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast)
  • Synonym(s):

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links