Difference between revisions of "DCTCP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == * smiles: ** CCC=CCC=CCC=CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTCP DCTCP] == * direction: ** LEFT-TO-RIGHT * common name: ** dCTP:cytidine 5'-phosphotransferase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTCP DCTCP] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M
+
 
* common name:
 
* common name:
−
** icosapentaenoate
+
** dCTP:cytidine 5'-phosphotransferase
−
* molecular weight:
+
−
** 301.448   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate
 
−
** timnodonic acid
 
−
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate
 
−
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid
 
−
** EPA
 
−
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate
 
−
** eicosapentaenoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12978]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DCTP]][c] '''+''' 1.0 [[CYTIDINE]][c] '''=>''' 1.0 [[CMP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[DCDP]][c]
−
* [[RXN-16139]]
+
* With common name(s):
−
* [[RXN-13431]]
+
** 1.0 dCTP[c] '''+''' 1.0 cytidine[c] '''=>''' 1.0 CMP[c] '''+''' 1.0 H+[c] '''+''' 1.0 dCDP[c]
−
* [[RXN-13430]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245749 25245749]
+
{{#set: common name=dCTP:cytidine 5'-phosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58562 58562]
+
{{#set: in pathway=}}
−
* Wikipedia : Eicosapentaenoate
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06428 C06428]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB01999
+
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M}}
+
−
{{#set: common name=icosapentaenoate}}
+
−
{{#set: molecular weight=301.448    }}
+
−
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate|timnodonic acid|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid|EPA|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoate|eicosapentaenoate}}
+
−
{{#set: consumed by=RXN-12978}}
+
−
{{#set: produced by=RXN-16139|RXN-13431|RXN-13430}}
+

Latest revision as of 19:15, 21 March 2018

Reaction DCTCP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dCTP:cytidine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 dCTP[c] + 1.0 cytidine[c] => 1.0 CMP[c] + 1.0 H+[c] + 1.0 dCDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DCTCP&oldid=40483"