Difference between revisions of "PWY-6883"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** pyruvate fermentation to butanol II (engineered) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-butanol synthesis |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''6''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Tiso_gene_16181]] | ||
| + | *** [[Tiso_gene_15327]] | ||
| + | *** [[Tiso_gene_17451]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-11662]] | ||
| + | ** 7 associated gene(s): | ||
| + | *** [[Tiso_gene_16703]] | ||
| + | *** [[Tiso_gene_14027]] | ||
| + | *** [[Tiso_gene_14262]] | ||
| + | *** [[Tiso_gene_14026]] | ||
| + | *** [[Tiso_gene_18838]] | ||
| + | *** [[Tiso_gene_18839]] | ||
| + | *** [[Tiso_gene_5857]] | ||
| + | ** 5 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-11667]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_5857]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | * [[RXN-161]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=BUTANAL-DEHYDROGENASE-RXN BUTANAL-DEHYDROGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12558 RXN-12558] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | {{#set: | + | {{#set: common name=pyruvate fermentation to butanol II (engineered)}} |
| − | {{#set: | + | {{#set: common name=1-butanol synthesis}} |
| − | {{#set: common name= | + | {{#set: reaction found=4}} |
| − | {{#set: | + | {{#set: total reaction=6}} |
| − | {{#set: | + | {{#set: completion rate=67.0}} |
| − | {{#set: | + | |
Latest revision as of 19:16, 21 March 2018
Pathway PWY-6883
- taxonomic range:
- common name:
- pyruvate fermentation to butanol II (engineered)
- Synonym(s):
- 1-butanol synthesis
Reaction(s) found
4 reactions found over 6 reactions in the full pathway
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-11662
- 7 associated gene(s):
- 5 reconstruction source(s) associated:
- RXN-11667
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-161
- 0 associated gene:
- 1 reconstruction source(s) associated:
