Difference between revisions of "MGLDLCTANA-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MGLDLCTANA-PWY MGLDLCTANA-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MGLDLCTANA-PWY MGLDLCTANA-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** methylglyoxal degradation VI |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''4''' reactions in the full pathway |
− | + | * [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_8488]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=LACTALDEHYDE-OXI-RXN LACTALDEHYDE-OXI-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8641 RXN-8641] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-40674}} | |
− | + | {{#set: common name=methylglyoxal degradation VI}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:16, 21 March 2018
Pathway MGLDLCTANA-PWY
- taxonomic range:
- common name:
- methylglyoxal degradation VI
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- D-LACTALDEHYDE-DEHYDROGENASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: