Difference between revisions of "Tiso gene 1943"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_1943 == * Synonym(s): == Reactions associated == * Reaction: URANA1t ** Source: orthology-creinhardtii == Pathways associated == =...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_1943 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[URANA1t]] |
| − | * [[ | + | ** Source: [[orthology-creinhardtii]] |
| − | == | + | == Pathways associated == |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=URANA1t}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:16, 21 March 2018
Gene Tiso_gene_1943
- Synonym(s):
Reactions associated
- Reaction: URANA1t
- Source: orthology-creinhardtii
