Difference between revisions of "BENZOATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7270 PWY-7270] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOATE BENZOATE] == * smiles: ** C(C1(C=CC=CC=1))([O-])=O * common name: ** benzoate * inchi...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOATE BENZOATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(C1(C=CC=CC=1))([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** benzoate |
+ | * inchi key: | ||
+ | ** InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 121.115 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** benzoic acid |
− | ** | + | ** benzenecarboxylic acid |
− | ** | + | ** phenylformic acid |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] | |
− | + | ||
− | == Reaction(s) | + | |
− | * | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 65-85-0 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=242 242] |
− | {{#set: | + | * HMDB : HMDB01870 |
− | {{#set: reaction | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00180 C00180] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.237.html 237] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16150 16150] | ||
+ | * METABOLIGHTS : MTBLC16150 | ||
+ | {{#set: smiles=C(C1(C=CC=CC=1))([O-])=O}} | ||
+ | {{#set: common name=benzoate}} | ||
+ | {{#set: inchi key=InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=121.115 }} | ||
+ | {{#set: common name=benzoic acid|benzenecarboxylic acid|phenylformic acid}} | ||
+ | {{#set: produced by=BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN}} | ||
+ | {{#set: reversible reaction associated=BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN}} |
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite BENZOATE
- smiles:
- C(C1(C=CC=CC=1))([O-])=O
- common name:
- benzoate
- inchi key:
- InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M
- molecular weight:
- 121.115
- Synonym(s):
- benzoic acid
- benzenecarboxylic acid
- phenylformic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 65-85-0
- PUBCHEM:
- HMDB : HMDB01870
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16150
"C(C1(C=CC=CC=1))([O-])=O" cannot be used as a page name in this wiki.