Difference between revisions of "CPD-723"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12097 == * left end position: ** 2 * transcription direction: ** POSITIVE * right end position: ** 3870 * centisome position: ** 2.74122800...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] == |
− | * | + | * smiles: |
− | ** 2 | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34)))) |
− | * | + | * common name: |
− | ** | + | ** 6-deoxocastasterone |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 450.701 |
* Synonym(s): | * Synonym(s): | ||
+ | ** deoxocastasterone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-778]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMST01030127 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13870433 13870433] |
− | {{#set: | + | * HMDB : HMDB33984 |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20712 20712] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15802 C15802] | ||
+ | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=6-deoxocastasterone}} | ||
+ | {{#set: inchi key=InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N}} | ||
+ | {{#set: molecular weight=450.701 }} | ||
+ | {{#set: common name=deoxocastasterone}} | ||
+ | {{#set: consumed by=RXN-778}} |
Latest revision as of 19:05, 21 March 2018
Contents
Metabolite CPD-723
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
- common name:
- 6-deoxocastasterone
- inchi key:
- InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N
- molecular weight:
- 450.701
- Synonym(s):
- deoxocastasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.