Difference between revisions of "R00939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00939 R00939] == * direction: ** LEFT-TO-RIGHT * common name: ** R143 * Synonym(s): == Reaction F...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00939 R00939] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
+
 
* common name:
 
* common name:
** ω-saturated C55 dolichol phosphate
+
** R143
* molecular weight:
+
** 849.311   
+
 
* Synonym(s):
 
* Synonym(s):
** ω-saturated dolichol-11 phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-16602]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[DIHYDROFOLATE]][c] '''=>''' 1.0 [[THF]][c] '''+''' 1.0 [[NADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NADPH[c] '''+''' 1.0 H+[c] '''+''' 1.0 7,8-dihydrofolate monoglutamate[c] '''=>''' 1.0 tetrahydropteroyl mono-L-glutamate[c] '''+''' 1.0 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11659]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
+
{{#set: common name=R143}}
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
+
{{#set: gene associated=Tiso_gene_11659}}
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
+
{{#set: in pathway=}}
{{#set: common name=ω-saturated C55 dolichol phosphate}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=849.311    }}
+
{{#set: reconstruction source=orthology-synechocystis}}
{{#set: common name=ω-saturated dolichol-11 phosphate}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: consumed by=RXN-16602}}
+

Latest revision as of 19:18, 21 March 2018

Reaction R00939

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R143
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NADPH[c] + 1.0 H+[c] + 1.0 7,8-dihydrofolate monoglutamate[c] => 1.0 tetrahydropteroyl mono-L-glutamate[c] + 1.0 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links