Difference between revisions of "PWY-7295"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295] ==
* smiles:
+
* taxonomic range:
** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N
+
 
* common name:
 
* common name:
** (S)-equol
+
** L-arabinose degradation IV
* molecular weight:
+
** 242.274   
+
 
* Synonym(s):
 
* Synonym(s):
** 4',7-isoflavandiol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''8''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[GLYCOLATE-REDUCTASE-RXN]]
* [[RXN-15589]]
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_91]]
 +
*** [[Tiso_gene_777]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
* [[MALSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_14377]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-14809]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4.1.2.18-RXN 4.1.2.18-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONATE-DEHYDRATASE-RXN L-ARABINONATE-DEHYDRATASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONOLACTONASE-RXN L-ARABINONOLACTONASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14642 RXN-14642]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8774 RXN-8774]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2157}}
** [http://www.genome.jp/dbget-bin/www_bget?C14131 C14131]
+
{{#set: common name=L-arabinose degradation IV}}
* Wikipedia : Equol
+
{{#set: reaction found=3}}
* HMDB : HMDB02209
+
{{#set: total reaction=8}}
* CHEBI:
+
{{#set: completion rate=38.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34741 34741]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91469 91469]
+
{{#set: smiles=C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)}}
+
{{#set: inchi key=InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N}}
+
{{#set: common name=(S)-equol}}
+
{{#set: molecular weight=242.274    }}
+
{{#set: common name=4',7-isoflavandiol}}
+
{{#set: consumed or produced by=RXN-15589}}
+

Latest revision as of 19:19, 21 March 2018

Pathway PWY-7295

  • taxonomic range:
  • common name:
    • L-arabinose degradation IV
  • Synonym(s):

Reaction(s) found

3 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links