Difference between revisions of "PWY-881"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * inchi key: ** InChIKey=UH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-881 PWY-881] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-881 PWY-881] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** trehalose biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** trehalose biosynthesis 2 |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[TREHALOSEPHOSPHA-RXN]] |
| − | * [ | + | ** 3 associated gene(s): |
| + | *** [[Tiso_gene_10840]] | ||
| + | *** [[Tiso_gene_18196]] | ||
| + | *** [[Tiso_gene_14220]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-761 RXN-761] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-201174}} | |
| − | + | {{#set: common name=trehalose biosynthesis II}} | |
| − | + | {{#set: common name=trehalose biosynthesis 2}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Pathway PWY-881
- taxonomic range:
- common name:
- trehalose biosynthesis II
- Synonym(s):
- trehalose biosynthesis 2
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- TREHALOSEPHOSPHA-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
