Difference between revisions of "CPD-11404"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9871 == * left end position: ** 4369 * transcription direction: ** NEGATIVE * right end position: ** 5930 * centisome position: ** 48.53366...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * co...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_9871 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
* left end position:
+
* smiles:
** 4369
+
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
* transcription direction:
+
* common name:
** NEGATIVE
+
** 3,3',5-triiodothyroacetate
* right end position:
+
* inchi key:
** 5930
+
** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
* centisome position:
+
* molecular weight:
** 48.53366    
+
** 620.928    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,3',5-triiodothyroacetic acid
 +
** Triac
 +
** Tiratricol
 +
** Tiracana
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-12968]]
+
* [[RXN-10618]]
** in-silico_annotation
+
* [[RXN-10619]]
***ec-number
+
== Reaction(s) known to produce the compound ==
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[RXN-12994]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13298]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13299]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13300]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13301]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13443]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-14484]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-14493]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16020]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16095]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16112]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16129]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16154]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-17109]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-7698]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-7053]]
+
* [[PWY-5353]]
+
* [[PWY-7619]]
+
* [[PWY-6433]]
+
* [[PWY-7602]]
+
* [[PWY-7049]]
+
* [[PWY-7601]]
+
* [[PWY-7606]]
+
* [[PWY-6958]]
+
* [[PWY-7728]]
+
* [[PWY-6598]]
+
* [[PWY-7036]]
+
* [[PWY-7592]]
+
* [[PWY-5080]]
+
* [[PWY-7725]]
+
* [[PWY-7724]]
+
* [[PWY-7727]]
+
* [[PWY-7726]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4369}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629]
{{#set: right end position=5930}}
+
* CHEMSPIDER:
{{#set: centisome position=48.53366   }}
+
** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972]
{{#set: reaction associated=RXN-12968|RXN-12994|RXN-13298|RXN-13299|RXN-13300|RXN-13301|RXN-13443|RXN-14484|RXN-14493|RXN-16020|RXN-16095|RXN-16112|RXN-16129|RXN-16154|RXN-17109|RXN-7698}}
+
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}}
{{#set: pathway associated=PWY-7053|PWY-5353|PWY-7619|PWY-6433|PWY-7602|PWY-7049|PWY-7601|PWY-7606|PWY-6958|PWY-7728|PWY-6598|PWY-7036|PWY-7592|PWY-5080|PWY-7725|PWY-7724|PWY-7727|PWY-7726}}
+
{{#set: common name=3,3',5-triiodothyroacetate}}
 +
{{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=620.928   }}
 +
{{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}}
 +
{{#set: consumed by=RXN-10618|RXN-10619}}

Latest revision as of 19:14, 21 March 2018

Metabolite CPD-11404

  • smiles:
    • C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
  • common name:
    • 3,3',5-triiodothyroacetate
  • inchi key:
    • InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
  • molecular weight:
    • 620.928
  • Synonym(s):
    • 3,3',5-triiodothyroacetic acid
    • Triac
    • Tiratricol
    • Tiracana

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))" cannot be used as a page name in this wiki.