Difference between revisions of "CPD-11404"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9871 == * left end position: ** 4369 * transcription direction: ** NEGATIVE * right end position: ** 5930 * centisome position: ** 48.53366...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * co...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) |
− | * | + | * common name: |
− | ** | + | ** 3,3',5-triiodothyroacetate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 620.928 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3,3',5-triiodothyroacetic acid | ||
+ | ** Triac | ||
+ | ** Tiratricol | ||
+ | ** Tiracana | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-10618]] |
− | + | * [[RXN-10619]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972] |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}} |
− | {{#set: | + | {{#set: common name=3,3',5-triiodothyroacetate}} |
+ | {{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=620.928 }} | ||
+ | {{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}} | ||
+ | {{#set: consumed by=RXN-10618|RXN-10619}} |
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite CPD-11404
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
- common name:
- 3,3',5-triiodothyroacetate
- inchi key:
- InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
- molecular weight:
- 620.928
- Synonym(s):
- 3,3',5-triiodothyroacetic acid
- Triac
- Tiratricol
- Tiracana
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))" cannot be used as a page name in this wiki.