Difference between revisions of "Tiso gene 16490"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_16490 == * right end position: ** 3521 * transcription direction: ** NEGATIVE * left end position: ** 443 * centisome position: ** 10.25225...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16490 == |
− | * | + | * right end position: |
− | ** | + | ** 3521 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 443 |
− | * | + | * centisome position: |
− | ** | + | ** 10.252256 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.5.1.98-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: right end position=3521}} |
− | {{#set: | + | {{#set: transcription direction=NEGATIVE}} |
− | {{#set: | + | {{#set: left end position=443}} |
− | {{#set: | + | {{#set: centisome position=10.252256 }} |
− | {{#set: | + | {{#set: reaction associated=3.5.1.98-RXN}} |
− | + |
Latest revision as of 19:19, 21 March 2018
Gene Tiso_gene_16490
- right end position:
- 3521
- transcription direction:
- NEGATIVE
- left end position:
- 443
- centisome position:
- 10.252256
- Synonym(s):
Reactions associated
- Reaction: 3.5.1.98-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation