Difference between revisions of "CPD-14876"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] == * smiles: ** C1(NC=C(CC(=O)[O-])N=1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * common name: ** 3-ace...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 4- | + | ** 3-acetylamino-4-hydroxybenzaldehyde |
| + | * inchi key: | ||
| + | ** InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 178.167 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13871]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657664 90657664] |
| − | + | {{#set: smiles=CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)}} | |
| − | + | {{#set: common name=3-acetylamino-4-hydroxybenzaldehyde}} | |
| − | + | {{#set: inchi key=InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M}} | |
| − | + | {{#set: molecular weight=178.167 }} | |
| − | + | {{#set: reversible reaction associated=RXN-13871}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-14876
- smiles:
- CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)
- common name:
- 3-acetylamino-4-hydroxybenzaldehyde
- inchi key:
- InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M
- molecular weight:
- 178.167
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)" cannot be used as a page name in this wiki.
