Difference between revisions of "PWY-6605"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6605 PWY-6605] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6605 PWY-6605] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** adenine and adenosine salvage II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** adenosine nucleosides salvage II |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[ADENOSINE-NUCLEOSIDASE-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_9396]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ADENPRIBOSYLTRAN-RXN ADENPRIBOSYLTRAN-RXN] | ||
== External links == | == External links == | ||
− | {{#set: | + | * ECOCYC: |
− | {{#set: | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6605 PWY-6605] |
− | {{#set: common name= | + | {{#set: taxonomic range=TAX-2759}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
− | {{#set: | + | {{#set: common name=adenine and adenosine salvage II}} |
− | {{#set: | + | {{#set: common name=adenosine nucleosides salvage II}} |
+ | {{#set: reaction found=1}} | ||
+ | {{#set: total reaction=2}} | ||
+ | {{#set: completion rate=50.0}} |
Latest revision as of 19:19, 21 March 2018
Pathway PWY-6605
- taxonomic range:
- common name:
- adenine and adenosine salvage II
- Synonym(s):
- adenosine nucleosides salvage II
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- ADENOSINE-NUCLEOSIDASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: