Difference between revisions of "PWY-1422"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1422 PWY-1422] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1422 PWY-1422] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-2870] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* common name: | * common name: | ||
− | ** | + | ** vitamin E biosynthesis (tocopherols) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** tocopherol biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''7''' reactions in the full pathway | |
− | * [[ | + | * [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]] |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[Tiso_gene_18977]] | ||
+ | *** [[Tiso_gene_18976]] | ||
+ | *** [[Tiso_gene_18328]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-2541]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_13582]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[RXN-2542]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_11392]] | ||
+ | *** [[Tiso_gene_2596]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-2562]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_6738]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_6738]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2543 RXN-2543] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2561 RXN-2561] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-1422 PWY-1422] |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-3041}} | |
− | + | {{#set: taxonomic range=TAX-2870}} | |
− | + | {{#set: taxonomic range=TAX-2763}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=vitamin E biosynthesis (tocopherols)}} | |
− | {{#set: | + | {{#set: common name=tocopherol biosynthesis}} |
− | {{#set: | + | {{#set: reaction found=5}} |
− | {{#set: common name= | + | {{#set: total reaction=7}} |
− | {{#set: | + | {{#set: completion rate=71.0}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Pathway PWY-1422
- taxonomic range:
- common name:
- vitamin E biosynthesis (tocopherols)
- Synonym(s):
- tocopherol biosynthesis
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- 4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-2541
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-2542
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-2562
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- TOCOPHEROL-O-METHYLTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: