Difference between revisions of "3.1.4.17-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.4.17-RXN 3.1.4.17-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** iesterase_family_memb...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.4.17-RXN 3.1.4.17-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** iesterase_family_member |
− | * | + | ** amino_acid_transporter |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.1.4.17 EC-3.1.4.17] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[WATER]][c] '''+''' 1 [[Cyclic-3-5-Nucleoside-Monophosphates]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Nucleoside-Monophosphates]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 H2O[c] '''+''' 1 a nucleoside cyclic 3',5'-monophosphate[c] '''=>''' 1 H+[c] '''+''' 1 a nucleoside 5'-monophosphate[c] | |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_9644]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Gene: [[Tiso_gene_1763]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_12792]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14653 14653] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03259 R03259] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P12019 P12019] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q56686 Q56686] |
− | * | + | ** [http://www.uniprot.org/uniprot/P14099 P14099] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q01066 Q01066] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q01061 Q01061] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P14100 P14100] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q01065 Q01065] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P27815 P27815] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O66909 O66909] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P14270 P14270] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O27755 O27755] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P44685 P44685] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P22434 P22434] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0AEW4 P0AEW4] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O26280 O26280] |
+ | ** [http://www.uniprot.org/uniprot/O06629 O06629] | ||
+ | ** [http://www.uniprot.org/uniprot/O30241 O30241] | ||
+ | ** [http://www.uniprot.org/uniprot/P14644 P14644] | ||
+ | ** [http://www.uniprot.org/uniprot/P54748 P54748] | ||
+ | ** [http://www.uniprot.org/uniprot/Q13945 Q13945] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01062 Q01062] | ||
+ | ** [http://www.uniprot.org/uniprot/P54827 P54827] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01064 Q01064] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9NP56 Q9NP56] | ||
+ | ** [http://www.uniprot.org/uniprot/O60658 O60658] | ||
+ | ** [http://www.uniprot.org/uniprot/P36599 P36599] | ||
+ | ** [http://www.uniprot.org/uniprot/P30645 P30645] | ||
+ | ** [http://www.uniprot.org/uniprot/Q45859 Q45859] | ||
+ | ** [http://www.uniprot.org/uniprot/P12252 P12252] | ||
+ | ** [http://www.uniprot.org/uniprot/P06776 P06776] | ||
+ | ** [http://www.uniprot.org/uniprot/Q08493 Q08493] | ||
+ | ** [http://www.uniprot.org/uniprot/Q63421 Q63421] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=iesterase_family_member}} | ||
+ | {{#set: common name=amino_acid_transporter}} | ||
+ | {{#set: ec number=EC-3.1.4.17}} | ||
+ | {{#set: gene associated=Tiso_gene_9644|Tiso_gene_1763|Tiso_gene_12792}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:20, 21 March 2018
Contents
Reaction 3.1.4.17-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- iesterase_family_member
- amino_acid_transporter
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Cyclic-3-5-Nucleoside-Monophosphates[c] => 1 PROTON[c] + 1 Nucleoside-Monophosphates[c]
- With common name(s):
- 1 H2O[c] + 1 a nucleoside cyclic 3',5'-monophosphate[c] => 1 H+[c] + 1 a nucleoside 5'-monophosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9644
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1763
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12792
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: