Difference between revisions of "CPD-13913"

Latest revision as of 19:20, 21 March 2018

"C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_10793 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] ==
-* left end position:
+* smiles:
-** 2380
+** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
-* transcription direction:
+* common name:
-** POSITIVE
+** 2-carboxy-L-xylonolactone
-* right end position:
+* inchi key:
-** 5834
+** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
-* centisome position:
+* molecular weight:
-** 28.712753
+** 191.117
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[2.7.11.24-RXN]]
+* [[RXN-12871]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***automated-name-match
+* [[RXN-12870]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: left end position=2380}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445]
-{{#set: right end position=5834}}
+{{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}}
-{{#set: centisome position=28.712753    }}
+{{#set: common name=2-carboxy-L-xylonolactone}}
-{{#set: reaction associated=2.7.11.24-RXN}}
+{{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}}
+{{#set: molecular weight=191.117    }}
+{{#set: consumed by=RXN-12871}}
+{{#set: produced by=RXN-12870}}