Difference between revisions of "A-5-prime-PP-5-prime-DNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO PRO] == * smiles: ** C1([N+]C(CC1)C(=O)[O-]) * inchi key: ** InChIKey=ONIBWKKTOPOVIA-BYPYZU...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-5-prime-PP-5-prime-DNA A-5-prime-PP-5-prime-DNA] == * common name: ** a 5'-(5'-diphosphoadeno...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO PRO] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-5-prime-PP-5-prime-DNA A-5-prime-PP-5-prime-DNA] ==
−
* smiles:
+
−
** C1([N+]C(CC1)C(=O)[O-])
+
−
* inchi key:
+
−
** InChIKey=ONIBWKKTOPOVIA-BYPYZUCNSA-N
+
 
* common name:
 
* common name:
−
** L-proline
+
** a 5'-(5'-diphosphoadenosine)-[DNA]
−
* molecular weight:
+
−
** 115.132   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-pyrrolidinecarboxylic acid
+
** A5'pp5'DNA
−
** P
+
** a DNA with 5'App
−
** proline
+
−
** prol
+
−
** pro
+
−
** L-pro
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN490-3641]]
+
* [[RXN-17919]]
−
* [[RME144]]
+
−
* [[RXN-14903]]
+
−
* [[PROLINE--TRNA-LIGASE-RXN]]
+
−
* [[TRANS-RXN-118]]
+
−
* [[RXN0-7008]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-7005]]
+
* [[RXN-17918]]
−
* [[3.4.11.5-RXN]]
+
−
* [[PYRROLINECARBREDUCT-RXN]]
+
−
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
+
−
* [[R01251]]
+
−
* [[TRANS-RXN-118]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[PROLINE-RACEMASE-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 147-85-3
+
{{#set: common name=a 5'-(5'-diphosphoadenosine)-[DNA]}}
−
* METABOLIGHTS : MTBLC60039
+
{{#set: common name=A5'pp5'DNA|a DNA with 5'App}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-17919}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971047 6971047]
+
{{#set: produced by=RXN-17918}}
−
* HMDB : HMDB00162
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00148 C00148]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60039 60039]
+
−
* BIGG : pro__L
+
−
{{#set: smiles=C1([N+]C(CC1)C(=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=ONIBWKKTOPOVIA-BYPYZUCNSA-N}}
+
−
{{#set: common name=L-proline}}
+
−
{{#set: molecular weight=115.132    }}
+
−
{{#set: common name=2-pyrrolidinecarboxylic acid|P|proline|prol|pro|L-pro}}
+
−
{{#set: consumed by=RXN490-3641|RME144|RXN-14903|PROLINE--TRNA-LIGASE-RXN|TRANS-RXN-118|RXN0-7008}}
+
−
{{#set: produced by=RXN0-7005|3.4.11.5-RXN|PYRROLINECARBREDUCT-RXN|ORNITHINE-CYCLODEAMINASE-RXN|R01251|TRANS-RXN-118}}
+
−
{{#set: consumed or produced by=PROLINE-RACEMASE-RXN}}
+

Latest revision as of 19:20, 21 March 2018

Metabolite A-5-prime-PP-5-prime-DNA

  • common name:
    • a 5'-(5'-diphosphoadenosine)-[DNA]
  • Synonym(s):
    • A5'pp5'DNA
    • a DNA with 5'App

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 5'-(5'-diphosphoadenosine)-[DNA" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=A-5-prime-PP-5-prime-DNA&oldid=40989"