Difference between revisions of "IS30-Insertion-Sequences"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IS30-Insertion-Sequences IS30-Insertion-Sequences] == * common name: ** an insertion sequence e...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IS30-Insertion-Sequences IS30-Insertion-Sequences] ==
* smiles:
+
** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
+
 
* common name:
 
* common name:
** (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
+
** an insertion sequence element IS30
* molecular weight:
+
** 1051.975   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16097]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16096]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN0-5131]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an insertion sequence element IS30}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193765 72193765]
+
{{#set: reversible reaction associated=RXN0-5131}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76409 76409]
+
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J}}
+
{{#set: common name=(2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA}}
+
{{#set: molecular weight=1051.975    }}
+
{{#set: consumed by=RXN-16097}}
+
{{#set: produced by=RXN-16096}}
+

Latest revision as of 19:20, 21 March 2018

Metabolite IS30-Insertion-Sequences

  • common name:
    • an insertion sequence element IS30
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links