Difference between revisions of "CPD-7616"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-hydroxydecanoyl-ACPs Beta-hydroxydecanoyl-ACPs] == * common name: ** a (3R)-3-hydroxydecan...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * common name: ** 3,4-dihydroxybenz...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == |
+ | * smiles: | ||
+ | ** C(C1(C=C(C(=CC=1)O)O))=O | ||
* common name: | * common name: | ||
− | ** | + | ** 3,4-dihydroxybenzaldehyde |
+ | * inchi key: | ||
+ | ** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 138.123 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** protocatechualdehyde |
− | ** | + | ** 3,4-dihydroxybenzyl aldehyde |
+ | ** rancinamycin IV | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8872]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: produced by=RXN- | + | ** [http://www.chemspider.com/Chemical-Structure.8438.html 8438] |
+ | * HMDB : HMDB59965 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700] | ||
+ | {{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}} | ||
+ | {{#set: common name=3,4-dihydroxybenzaldehyde}} | ||
+ | {{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=138.123 }} | ||
+ | {{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}} | ||
+ | {{#set: produced by=RXN-8872}} |
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite CPD-7616
- smiles:
- C(C1(C=C(C(=CC=1)O)O))=O
- common name:
- 3,4-dihydroxybenzaldehyde
- inchi key:
- InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
- molecular weight:
- 138.123
- Synonym(s):
- protocatechualdehyde
- 3,4-dihydroxybenzyl aldehyde
- rancinamycin IV
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links