Difference between revisions of "ETF-Reduced"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETF-Reduced ETF-Reduced] == * common name: ** a reduced electron-transfer flavoprotein * Synony...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETF-Reduced ETF-Reduced] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a reduced electron-transfer flavoprotein |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ETFH2 |
− | ** | + | ** a reduced ETF |
+ | ** a reduced electron-transferring flavoprotein | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16557]] |
− | + | * [[RXN0-2301]] | |
− | + | * [[RXN66-576]] | |
− | * [[ | + | * [[SARCOSINE-DEHYDROGENASE-RXN]] |
− | + | * [[RXN-17784]] | |
− | + | * [[DIMETHYLGLYCINE-DEHYDROGENASE-RXN]] | |
− | + | * [[ACYLCOADEHYDROG-RXN]] | |
− | + | * [[RXN-17788]] | |
− | + | * [[RXN-17796]] | |
− | + | * [[RXN-17779]] | |
− | + | * [[RXN-13615]] | |
− | + | * [[RXN-13451]] | |
− | + | * [[RXN66-577]] | |
− | + | * [[RXN-17783]] | |
− | + | * [[RXN-16540]] | |
− | + | * [[RXN-17792]] | |
− | + | * [[RXN-14131]] | |
− | + | * [[RXN-17775]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN66- | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | * [[RXN- | + | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | * [[RXN- | + | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | * [[RXN66- | + | |
− | * [[RXN- | + | |
− | * [[RXN- | + | |
− | * [[ | + | |
− | + | ||
− | * [[RXN- | + | |
− | * [[ | + | |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-11734]] |
− | * [[RXN- | + | * [[RXN-14262]] |
− | * [[ | + | * [[1.5.5.1-RXN]] |
− | * [[ | + | * [[RXN-14278]] |
+ | * [[LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN]] | ||
+ | * [[RXN-14229]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a reduced electron-transfer flavoprotein}} | |
− | + | {{#set: common name=ETFH2|a reduced ETF|a reduced electron-transferring flavoprotein}} | |
− | + | {{#set: produced by=RXN-16557|RXN0-2301|RXN66-576|SARCOSINE-DEHYDROGENASE-RXN|RXN-17784|DIMETHYLGLYCINE-DEHYDROGENASE-RXN|ACYLCOADEHYDROG-RXN|RXN-17788|RXN-17796|RXN-17779|RXN-13615|RXN-13451|RXN66-577|RXN-17783|RXN-16540|RXN-17792|RXN-14131|RXN-17775}} | |
− | + | {{#set: reversible reaction associated=RXN-11734|RXN-14262|1.5.5.1-RXN|RXN-14278|LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN|RXN-14229}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: produced by= | + | |
− | + |
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite ETF-Reduced
- common name:
- a reduced electron-transfer flavoprotein
- Synonym(s):
- ETFH2
- a reduced ETF
- a reduced electron-transferring flavoprotein
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- RXN-16557
- RXN0-2301
- RXN66-576
- SARCOSINE-DEHYDROGENASE-RXN
- RXN-17784
- DIMETHYLGLYCINE-DEHYDROGENASE-RXN
- ACYLCOADEHYDROG-RXN
- RXN-17788
- RXN-17796
- RXN-17779
- RXN-13615
- RXN-13451
- RXN66-577
- RXN-17783
- RXN-16540
- RXN-17792
- RXN-14131
- RXN-17775