Difference between revisions of "RXN-14074"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == * smiles: ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) * inchi...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14074 RXN-14074] == * direction: ** LEFT-TO-RIGHT * common name: ** adenylate_kinase_domain-con...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14074 RXN-14074] ==
−
* smiles:
+
* direction:
−
** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N
+
 
* common name:
 
* common name:
−
** α1,6-D mannobiose
+
** adenylate_kinase_domain-containing_protein_1
−
* molecular weight:
+
* ec number:
−
** 342.299   
+
** [http://enzyme.expasy.org/EC/2.7.4.4 EC-2.7.4.4]
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-mannosyl-(1->6)-D-mannose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[3.2.1.152-RXN]]
+
** 1 [[AMP]][c] '''+''' 1 [[GTP]][c] '''=>''' 1 [[GDP]][c] '''+''' 1 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 AMP[c] '''+''' 1 GTP[c] '''=>''' 1 GDP[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C01728 C01728]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29864 29864]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.388648.html 388648]
+
{{#set: common name=adenylate_kinase_domain-containing_protein_1}}
−
* CHEBI:
+
{{#set: ec number=EC-2.7.4.4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62357 62357]
+
{{#set: gene associated=Tiso_gene_195}}
−
* PUBCHEM:
+
{{#set: in pathway=}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439557 439557]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=α1,6-D mannobiose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=α-D-mannosyl-(1->6)-D-mannose}}
+
−
{{#set: produced by=3.2.1.152-RXN}}
+

Latest revision as of 19:21, 21 March 2018

Reaction RXN-14074

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • adenylate_kinase_domain-containing_protein_1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 AMP[c] + 1 GTP[c] => 1 GDP[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14074&oldid=41042"